CAS 128733-85-7
:5-TERT-BUTYL-2-METHOXYBENZENEBORONIC ACID
Description:
5-Tert-butyl-2-methoxybenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted aromatic ring. The tert-butyl group provides steric hindrance, which can influence its reactivity and solubility, while the methoxy group enhances its electronic properties. This compound is typically used in organic synthesis, particularly in Suzuki coupling reactions, where it serves as a boron source for the formation of carbon-carbon bonds. Its boronic acid functionality allows it to form reversible complexes with diols, making it useful in various applications, including drug development and materials science. The compound is generally stable under standard conditions but may require careful handling due to its reactivity with moisture and air. Additionally, its solubility in organic solvents can facilitate its use in various chemical reactions. As with many organoboron compounds, it is important to consider safety and environmental regulations when handling and disposing of this substance.
Formula:C11H17BO3
InChI:InChI=1/C11H17BO3/c1-11(2,3)8-5-6-10(15-4)9(7-8)12(13)14/h5-7,13-14H,1-4H3
SMILES:CC(C)(C)c1ccc(c(c1)B(O)O)OC
Synonyms:- (5-Tert-Butyl-2-Methoxy-Phenyl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-tert-Butyl-2-methoxybenzeneboronic acid, 98+%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C11H17BO3Purity:98+%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:208.06(5-(tert-Butyl)-2-methoxyphenyl)boronic acid
CAS:Formula:C11H17BO3Purity:95%Color and Shape:SolidMolecular weight:208.065-t-Butyl-2-methoxyphenylboronic acid
CAS:Formula:C11H17BO3Purity:95%Color and Shape:SolidMolecular weight:208.06195-(tert-Butyl)-2-methoxybenzeneboronic acid
CAS:5-(tert-Butyl)-2-methoxybenzeneboronic acidPurity:95%Color and Shape:White PowderMolecular weight:208.06g/mol



