
CAS 1287670-56-7
:4-Amino-1-cyclopentyl-1H-pyrazole-3-carboxamide
Description:
4-Amino-1-cyclopentyl-1H-pyrazole-3-carboxamide is a chemical compound characterized by its pyrazole core, which features an amino group and a cyclopentyl substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the amino group, which can participate in hydrogen bonding and influence solubility. The carboxamide functional group contributes to its polar nature, enhancing its interaction with biological systems. The cyclopentyl group may influence the compound's lipophilicity and steric properties, potentially affecting its pharmacokinetics and pharmacodynamics. As a pyrazole derivative, it may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. The compound's specific reactivity and stability can be influenced by environmental factors such as pH and temperature. Overall, 4-Amino-1-cyclopentyl-1H-pyrazole-3-carboxamide represents a unique structure that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C9H14N4O
InChI:InChI=1S/C9H14N4O/c10-7-5-13(6-3-1-2-4-6)12-8(7)9(11)14/h5-6H,1-4,10H2,(H2,11,14)
InChI key:InChIKey=ITSCSLHLIWIPFA-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=NN(C=C1N)C2CCCC2
Synonyms:- 1H-Pyrazole-3-carboxamide, 4-amino-1-cyclopentyl-
- 4-Amino-1-cyclopentyl-1H-pyrazole-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.