CAS 1287752-72-0

2-Methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-3-thiophenesulfonyl chloride

Description:

2-Methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-3-thiophenesulfonyl chloride is a chemical compound characterized by its complex structure, which includes a thiophene ring, a sulfonyl chloride functional group, and a pyrazole moiety with a trifluoromethyl substituent. This compound is typically used in organic synthesis and medicinal chemistry due to its reactive sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. The compound is likely to be a solid at room temperature and may exhibit moderate to high stability under standard conditions, although it can be sensitive to moisture due to the sulfonyl chloride functionality. Safety precautions are necessary when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or alcohols. Overall, its unique structural features make it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals.

Formula: C₉H₆ClF₃N₂O₂S₂

InChI: InChI=1S/C9H6ClF3N2O2S2/c1-4-7(19(10,16)17)3-6(18-4)5-2-8(15-14-5)9(11,12)13/h2-3H,1H3,(H,14,15)

InChI key: InChIKey=ZTYVPQJIYIFDSJ-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C=C(SC1C)C=2C=C(C(F)(F)F)NN2

Synonyms:

• 3-Thiophenesulfonyl chloride, 2-methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-
• 2-Methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-3-thiophenesulfonyl chloride

2-methyl-5-[5-(trifluoromethyl)-1H-pyrazol-3-yl]-3-thiophenesulfonyl chloride

CAS: 1287752-72-0

Formula: C₉H₆ClF₃N₂O₂S₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 330.72

Ref: 10-F312926