CAS 1287752-78-6

4-Bromo-3-(methoxymethyl)-5-methyl-1H-pyrazole

Description:

4-Bromo-3-(methoxymethyl)-5-methyl-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a methoxymethyl group at the 3-position contributes to its unique reactivity and potential applications in medicinal chemistry. The methyl group at the 5-position enhances its lipophilicity, which can influence its biological activity and solubility. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced efficacy or selectivity. Additionally, the presence of functional groups such as the methoxy and bromo substituents can facilitate interactions with biological targets, potentially leading to applications in agrochemicals or pharmaceuticals. As with many pyrazole derivatives, the compound's characteristics, including stability and reactivity, can be influenced by environmental factors and the presence of other chemical species.

Formula: C₆H₉BrN₂O

InChI: InChI=1S/C6H9BrN2O/c1-4-6(7)5(3-10-2)9-8-4/h3H2,1-2H3,(H,8,9)

InChI key: InChIKey=UXQSDVYMXCEJHH-UHFFFAOYSA-N

SMILES: C(OC)C=1C(Br)=C(C)NN1

Synonyms:

• 1H-Pyrazole, 4-bromo-3-(methoxymethyl)-5-methyl-
• 4-Bromo-3-(methoxymethyl)-5-methyl-1H-pyrazole
• 4-bromo-5-(methoxymethyl)-3-methyl-1H-pyrazole