CAS 1287753-34-7

B-[4-Methoxy-2-(1H-pyrazol-1-yl)phenyl]boronic acid

Description:

B-[4-Methoxy-2-(1H-pyrazol-1-yl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a phenyl ring substituted with a methoxy group and a pyrazole moiety, contributing to its potential biological activity and reactivity. The boronic acid group allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. Additionally, the presence of the pyrazole ring may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents. Its reactivity and functional groups suggest potential applications in drug development, materials science, and as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential hazards associated with boronic acids.

Formula: C₁₀H₁₁BN₂O₃

InChI: InChI=1S/C10H11BN2O3/c1-16-8-3-4-9(11(14)15)10(7-8)13-6-2-5-12-13/h2-7,14-15H,1H3

InChI key: InChIKey=HNIWENQDOKNTLY-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(C=C(OC)C=C1)N2C=CC=N2

Synonyms:

• B-[4-Methoxy-2-(1H-pyrazol-1-yl)phenyl]boronic acid
• Boronic acid, B-[4-methoxy-2-(1H-pyrazol-1-yl)phenyl]-

[4-Methoxy-2-(1H-pyrazol-1-yl)phenyl]boronic acid

CAS: 1287753-34-7

Formula: C₁₀H₁₁BN₂O₃

Molecular weight: 218.0169

Ref: IN-DA009C23

[4-methoxy-2-(1H-pyrazol-1-yl)phenyl]boronic acid

CAS: 1287753-34-7

Formula: C₁₀H₁₁BN₂O₃

Purity: 95.0%

Molecular weight: 218.02

Ref: 10-F309556