CymitQuimica logo

CAS 1287753-36-9

:

B-[3-[1-(Dimethylamino)ethyl]phenyl]boronic acid

Description:
B-[3-[1-(Dimethylamino)ethyl]phenyl]boronic acid, identified by its CAS number 1287753-36-9, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and an amine-containing substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The dimethylamino group enhances its solubility in organic solvents and may influence its reactivity and biological activity. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in the synthesis of complex organic molecules. The specific structure of this compound suggests potential applications in drug development, particularly in the design of inhibitors targeting specific biological pathways. Overall, B-[3-[1-(Dimethylamino)ethyl]phenyl]boronic acid represents a versatile building block in synthetic chemistry.
Formula:C10H16BNO2
InChI:InChI=1S/C10H16BNO2/c1-8(12(2)3)9-5-4-6-10(7-9)11(13)14/h4-8,13-14H,1-3H3
InChI key:InChIKey=MGLNHFNWYLMGHC-UHFFFAOYSA-N
SMILES:C(N(C)C)(C)C1=CC(B(O)O)=CC=C1
Synonyms:
  • [3-[1-(Dimethylamino)ethyl]phenyl]boronic acid
  • Boronic acid, B-[3-[1-(dimethylamino)ethyl]phenyl]-
  • B-[3-[1-(Dimethylamino)ethyl]phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.