CymitQuimica logo

CAS 1287753-38-1

:

B-[4-Chloro-2-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]boronic acid

Description:
B-[4-Chloro-2-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. The compound features a chlorinated phenyl ring and a pyrazole moiety, which contribute to its potential biological activity and reactivity. The presence of the 3,5-dimethyl substituents on the pyrazole enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically utilized in cross-coupling reactions, such as Suzuki-Miyaura coupling, to form carbon-carbon bonds, making it valuable in the synthesis of complex organic molecules. Additionally, the boronic acid group can participate in various chemical transformations, including the formation of boronate esters. Its unique structure and functional groups suggest potential applications in pharmaceuticals, agrochemicals, and materials science, although specific biological activities and applications would require further investigation.
Formula:C11H12BClN2O2
InChI:InChI=1S/C11H12BClN2O2/c1-7-5-8(2)15(14-7)11-6-9(13)3-4-10(11)12(16)17/h3-6,16-17H,1-2H3
InChI key:InChIKey=RHBQEOVZNHLSCQ-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(C=C(Cl)C=C1)N2N=C(C)C=C2C
Synonyms:
  • B-[4-Chloro-2-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]boronic acid
  • Boronic acid, B-[4-chloro-2-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.