CAS 1287760-02-4

rel-Ethyl (1R,2R)-2-nitrocyclopropanecarboxylate

Description:

rel-Ethyl (1R,2R)-2-nitrocyclopropanecarboxylate is a chemical compound characterized by its cyclopropane structure, which features a nitro group and an ester functional group. The compound is chiral, with specific stereochemistry denoted by the (1R,2R) configuration, indicating the spatial arrangement of its atoms. This stereochemistry can influence its reactivity and interactions in biological systems. The presence of the nitro group typically imparts unique reactivity, making it a potential candidate for various chemical transformations. As an ester, it may exhibit properties such as volatility and solubility in organic solvents, which are common for such compounds. The compound's applications could range from synthetic intermediates in organic chemistry to potential roles in pharmaceuticals, depending on its biological activity. Safety and handling considerations are essential, as nitro compounds can be sensitive and may require specific precautions during use. Overall, rel-Ethyl (1R,2R)-2-nitrocyclopropanecarboxylate represents a structurally interesting compound with potential utility in various chemical contexts.

Formula: C₆H₉NO₄

InChI: InChI=1/C6H9NO4/c1-2-11-6(8)4-3-5(4)7(9)10/h4-5H,2-3H2,1H3/t4-,5-/s2

InChI key: InChIKey=XYGGYQYMJUQDKO-LXDRQGDMNA-N

SMILES: C(OCC)(=O)[C@@H]1[C@@H](N(=O)=O)C1

Synonyms:

• rel-Ethyl (1R,2R)-2-nitrocyclopropanecarboxylate
• Cyclopropanecarboxylic acid, 2-nitro-, ethyl ester, (1R,2R)-rel-