CAS 128781-81-7
:2-(Aminomethyl)-4-pyridinemethanol
Description:
2-(Aminomethyl)-4-pyridinemethanol, with the CAS number 128781-81-7, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an aminomethyl group and a hydroxymethyl group attached to the pyridine, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. It is typically a solid at room temperature and may exhibit hygroscopic properties, meaning it can absorb moisture from the air. The presence of both amino and hydroxyl functional groups suggests that it can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its reactivity can be attributed to the functional groups present, allowing for various chemical transformations. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c8-4-7-3-6(5-10)1-2-9-7/h1-3,10H,4-5,8H2
InChI key:InChIKey=OUGIEPITFNPGEJ-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(CN)N=CC1
Synonyms:- 4-Pyridinemethanol, 2-(aminomethyl)-
- 2-(Aminomethyl)-4-pyridinemethanol
- [2-(Aminomethyl)pyridin-4-yl]methanol
- (2-(Aminomethyl)pyridin-4-yl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
