CAS 128798-39-0
:4-PHENYLCYCLOHEXENYLISOCYANIDE
Description:
4-Phenylcyclohexenylisocyanide is an organic compound characterized by its unique structure, which includes a cyclohexene ring substituted with a phenyl group and an isocyanide functional group. Isocyanides are known for their distinctive reactivity, particularly in nucleophilic addition reactions, and can participate in various organic transformations, including the formation of ureas and carbamates. The presence of the phenyl group contributes to the compound's stability and can influence its electronic properties, potentially affecting its reactivity and interactions with other molecules. Additionally, the cyclohexene moiety introduces a degree of rigidity to the structure, which may impact its conformational behavior. This compound may be of interest in synthetic organic chemistry, particularly in the development of new materials or pharmaceuticals, due to the versatile reactivity of isocyanides. However, specific safety and handling information should be consulted, as isocyanides can be toxic and pose health risks. Overall, 4-phenylcyclohexenylisocyanide exemplifies the complexity and utility of isocyanide-containing compounds in chemical synthesis.
Formula:C13H13N
InChI:InChI=1S/C13H13N/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-6,9,12H,7-8,10H2
InChI key:InChIKey=MELZBCMFFALINW-UHFFFAOYSA-N
SMILES:[N+](#[C-])C=1CCC(CC1)C2=CC=CC=C2
Synonyms:- (4-Isocyano-3-cyclohexen-1-yl)benzene
- (4-Isocyano-Cyclohex-3-Enyl)-Benzene
- (4-Phenylcyclohex-1-Enyl)Isocyanide
- 1-Isocyano-4-phenylcyclohex-1-ene
- 4-Phenyl-1-cyclohexenyl isonitrile
- Benzene, (4-isocyano-3-cyclohexen-1-yl)-
- (4-isocyanocyclohex-3-en-1-yl)benzene
- 4-PHENYLCYCLOHEXENYLISOCYANIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
