CymitQuimica logo

CAS 128812-04-4

:

2,6-difluoro-3,4-dihydroxyphenylalanine

Description:
2,6-Difluoro-3,4-dihydroxyphenylalanine, identified by its CAS number 128812-04-4, is an amino acid derivative characterized by the presence of two fluorine atoms and two hydroxyl groups on the phenyl ring. This compound is a modified form of phenylalanine, which is an essential amino acid. The introduction of fluorine atoms can significantly influence the compound's chemical properties, such as its reactivity and interaction with biological systems. The hydroxyl groups contribute to its polarity, enhancing solubility in polar solvents and potentially affecting its biological activity. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways or conditions. Its structural modifications could lead to altered pharmacokinetics and pharmacodynamics compared to its non-fluorinated counterparts. Overall, 2,6-difluoro-3,4-dihydroxyphenylalanine exemplifies how small changes in molecular structure can lead to significant variations in chemical behavior and potential applications.
Formula:C9H9F2NO4
InChI:InChI=1/C9H9F2NO4/c10-4-2-6(13)8(14)7(11)3(4)1-5(12)9(15)16/h2,5,13-14H,1,12H2,(H,15,16)/t5-/m0/s1
SMILES:C(c1c(cc(c(c1F)O)O)F)[C@@H](C(=O)O)N
Synonyms:
  • 2,6-(18F)-Difluoro-dopa
  • 2,6-Difluorodopa
  • 2,6-difluoro-3-hydroxy-L-tyrosine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.