
CAS 128823-59-6
:(5Z)-5-Tetradecenedioic acid
Description:
(5Z)-5-Tetradecenedioic acid, also known as 5-tetradecenedioic acid, is a dicarboxylic acid characterized by a long carbon chain with a double bond at the fifth carbon position, specifically in the Z configuration. This compound features a total of 14 carbon atoms, with two carboxylic acid functional groups (-COOH) located at each end of the carbon chain. The presence of the double bond contributes to its unsaturation, influencing its reactivity and physical properties. Typically, dicarboxylic acids exhibit higher boiling points compared to their monocarboxylic counterparts due to increased hydrogen bonding capabilities. (5Z)-5-Tetradecenedioic acid may be utilized in various applications, including the synthesis of polymers, surfactants, and as intermediates in organic synthesis. Its unique structure can also impart specific properties that may be beneficial in biochemical applications or as a potential bioactive compound. As with many unsaturated fatty acids, it may exhibit varying degrees of solubility in organic solvents and limited solubility in water, depending on the length of the carbon chain and the presence of functional groups.
Formula:C14H24O4
InChI:InChI=1S/C14H24O4/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18/h3,5H,1-2,4,6-12H2,(H,15,16)(H,17,18)/b5-3-
InChI key:InChIKey=ZUAMFASDJCGODP-HYXAFXHYSA-N
SMILES:C(CC(O)=O)CCCCC/C=C\CCCC(O)=O
Synonyms:- 5-Tetradecenedioic acid, (5Z)-
- (5Z)-5-Tetradecenedioic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
