CAS 128831-46-9

1-[4-(2-chlorophenyl)-6,7-dimethyl-quinolin-3-yl]-3-(2,4-difluoropheny l)urea

Description:

1-[4-(2-chlorophenyl)-6,7-dimethyl-quinolin-3-yl]-3-(2,4-difluorophenyl)urea, with the CAS number 128831-46-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline moiety and urea functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of halogen substituents, specifically chlorine and fluorine, can influence its chemical reactivity and biological interactions, potentially enhancing its efficacy in targeted applications. The quinoline structure is known for its role in various biological activities, including antimicrobial and anticancer properties. Additionally, the compound's specific arrangement of functional groups may contribute to its pharmacokinetic profile, affecting absorption, distribution, metabolism, and excretion. Overall, this compound represents a class of molecules that may be explored for therapeutic applications, particularly in the development of new drugs targeting specific diseases.

Formula: C₂₄H₁₈ClF₂N₃O

InChI: InChI=1/C24H18ClF2N3O/c1-13-9-17-21(10-14(13)2)28-12-22(23(17)16-5-3-4-6-18(16)25)30-24(31)29-20-8-7-15(26)11-19(20)27/h3-12H,1-2H3,(H2,29,30,31)

SMILES: Cc1cc2c(cc1C)ncc(c2c1ccccc1Cl)NC(=Nc1ccc(cc1F)F)O

Synonyms:

• N-(4-(2-chlorophenyl)-6,7-dimethyl-3-quinolyl)-N'-(2,4-difluorophenyl)urea
• 1-[4-(2-Chlorophenyl)-6,7-Dimethylquinolin-3-Yl]-3-(2,4-Difluorophenyl)Urea

Urea, N-[4-(2-chlorophenyl)-6,7-dimethyl-3-quinolinyl]-N'-(2,4-difluorophenyl)-

CAS: 128831-46-9

Formula: C₂₄H₁₈ClF₂N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 437.869

Ref: IN-DA000YF7

TMP-153

CAS: 128831-46-9

TMP-153

Purity: ≥98%

Molecular weight: 437.87g/mol

Ref: 54-BUP02463

TMP-153

CAS: 128831-46-9

ACAT inhibitor TMP-153 reduces cholesterol and LDL in hamsters, with IC50 of 5-10 nM in animals and an ED50 of 0.81 mg/kg/day in diet.

Formula: C₂₄H₁₈ClF₂N₃O

Purity: 99.68%

Color and Shape: Solid

Molecular weight: 437.87

Ref: TM-T36126

1-[4-(2-Chlorophenyl)-6,7-Dimethylquinolin-3-Yl]-3-(2,4-Difluorophenyl)Urea

CAS: 128831-46-9

Please enquire for more information about 1-[4-(2-Chlorophenyl)-6,7-Dimethylquinolin-3-Yl]-3-(2,4-Difluorophenyl)Urea including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₄H₁₈ClF₂N₃O

Purity: Min. 95%

Molecular weight: 437.87 g/mol

Ref: 3D-FC99806