CymitQuimica logo

CAS 128833-96-5

:

Phenylalanine, 2,6-dichloro-, hydrochloride

Description:
Phenylalanine, 2,6-dichloro-, hydrochloride is a chemical compound characterized by its structure, which includes a phenylalanine backbone modified by the presence of two chlorine atoms at the 2 and 6 positions of the aromatic ring. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in biochemical research and pharmaceuticals. The presence of the chlorine substituents can influence the compound's biological activity and interaction with enzymes or receptors. As an amino acid derivative, it retains the basic properties of phenylalanine, including its role in protein synthesis and potential involvement in metabolic pathways. The hydrochloride form is often used to stabilize the compound and facilitate its handling in laboratory settings. Safety data sheets indicate that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, this compound is of interest in both synthetic chemistry and pharmacology due to its unique structural features and biological implications.
Formula:C9H9Cl2NO2·ClH
InChI:InChI=1S/C9H9Cl2NO2.ClH/c10-6-2-1-3-7(11)5(6)4-8(12)9(13)14;/h1-3,8H,4,12H2,(H,13,14);1H
InChI key:InChIKey=SSTFPAMFDCZJDF-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)N)C1=C(Cl)C=CC=C1Cl.Cl
Synonyms:
  • Phenylalanine, 2,6-dichloro-, hydrochloride
  • DL-Phenylalanine, 2,6-dichloro-, hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.