
CAS 128835-92-7
:Lipofectin
Description:
Lipofectin is a cationic lipid-based transfection reagent commonly used in molecular biology for delivering nucleic acids, such as DNA and RNA, into cells. It is composed of a mixture of lipids that facilitate the formation of liposomes, which encapsulate the genetic material and promote its uptake by cells through endocytosis. Lipofectin is particularly effective for transfecting a variety of cell types, including both adherent and suspension cells. Its mechanism involves the electrostatic interaction between the positively charged lipids and the negatively charged nucleic acids, leading to the formation of stable complexes. The reagent is known for its relatively low cytotoxicity compared to other transfection methods, making it suitable for applications requiring high cell viability. Additionally, Lipofectin is often used in research settings for gene expression studies, protein production, and functional assays. However, optimal transfection efficiency can vary depending on the specific cell type and experimental conditions, necessitating optimization for each application.
Formula:C42H84NO2·C41H78NO8P·Cl
InChI:InChI=1/C42H84NO2.C41H78NO8P.ClH/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-44-41-42(40-43(3,4)5)45-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(43)47-37-39(38-49-51(45,46)48-36-35-42)50-41(44)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h20-23,42H,6-19,24-41H2,1-5H3;17-20,39H,3-16,21-38,42H2,1-2H3,(H,45,46);1H/q+1;;/p-1/b22-20-,23-21-;19-17-,20-18-;
InChI key:InChIKey=BZFPNVBHFRTHMC-JVDGDQOCNA-M
SMILES:C(COCCCCCCCC/C=C\CCCCCCCC)(OCCCCCCCC/C=C\CCCCCCCC)C[N+](C)(C)C.[Cl-].C(OC(CCCCCCC/C=C\CCCCCCCC)=O)(COC(CCCCCCC/C=C\CCCCCCCC)=O)COP(OCCN)(=O)O
Synonyms:- 1-Propanaminium, N,N,N-trimethyl-2,3-bis[(9Z)-9-octadecen-1-yloxy]-, chloride, mixt. with 1-[[[(2-aminoethoxy)hydroxyphosphinyl]oxy]methyl]-1,2-ethanediyl di-(9Z)-9-octadecenoate
- 9-Octadecenoic acid (Z)-, 1-[[[(2-aminoethoxy)hydroxyphosphinyl]oxy]methyl]-1,2-ethanediyl ester, mixt. contg.
- 1-Propanaminium, N,N,N-trimethyl-2,3-bis[(9Z)-9-octadecenyloxy]-, chloride, mixt. with 1-[[[(2-aminoethoxy)hydroxyphosphinyl]oxy]methyl]-1,2-ethanediyl di-(9Z)-9-octadecenoate
- 9-Octadecenoic acid (9Z)-, 1-[[[(2-aminoethoxy)hydroxyphosphinyl]oxy]methyl]-1,2-ethanediyl ester, mixt. contg.
- 1-Propanaminium, N,N,N-trimethyl-2,3-bis(9-octadecenyloxy)-, chloride, (Z,Z)-, mixt. with (Z,Z)-1-[[[(2-aminoethoxy)hydroxyphosphinyl]oxy]methyl]-1,2-ethanediyl di-9-octadecenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lipofectin
CAS:<p>Lipofectin is used to promote the transfection of plasmid vectors in vitro and in vivo.</p>Formula:C83H162ClN2O10PColor and Shape:SolidMolecular weight:1414.64
