
CAS 128840-36-8
:4-(1,1-Dimethylethyl)-2-hydroxycyclohexyl 2-methyl-2-propenoate
Description:
4-(1,1-Dimethylethyl)-2-hydroxycyclohexyl 2-methyl-2-propenoate, with CAS number 128840-36-8, is an organic compound that belongs to the class of esters. It features a cyclohexyl ring substituted with a hydroxyl group and a tert-butyl group, contributing to its unique structural characteristics. This compound is typically used in the formulation of various products, including coatings and adhesives, due to its ability to enhance stability and performance. It exhibits properties such as good thermal stability and resistance to UV light, making it suitable for applications requiring durability. The presence of the methacrylate group allows for polymerization, which is advantageous in creating cross-linked networks in materials. Additionally, it is important to handle this substance with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be observed during its use. Overall, this compound plays a significant role in the development of advanced materials in the chemical industry.
Formula:C14H24O3
InChI:InChI=1S/C14H24O3/c1-9(2)13(16)17-12-7-6-10(8-11(12)15)14(3,4)5/h10-12,15H,1,6-8H2,2-5H3
InChI key:InChIKey=JZUCDZZFJRODNS-UHFFFAOYSA-N
SMILES:O(C(C(C)=C)=O)C1C(O)CC(C(C)(C)C)CC1
Synonyms:- 2-Propenoic acid, 2-methyl-, 4-(1,1-dimethylethyl)-2-hydroxycyclohexyl ester
- 4-tert-Butyl-2-hydroxycyclohexyl methacrylate
- 4-(1,1-Dimethylethyl)-2-hydroxycyclohexyl 2-methyl-2-propenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propenoic acid, 2-methyl-, 4-(1,1-dimethylethyl)-2-hydroxycyclohexyl ester
CAS:Formula:C14H24O3Molecular weight:240.3386
