CAS 128843-58-3

4-BENZOYL-1-METHYL-1H-PYRROLE-2-CARBALDEHYDE

Description:

4-Benzoyl-1-methyl-1H-pyrrole-2-carbaldehyde is an organic compound characterized by its unique pyrrole structure, which includes a benzoyl group and an aldehyde functional group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the benzoyl group contributes to its aromatic properties, while the aldehyde functionality allows for further chemical reactivity, such as condensation reactions. Its molecular structure suggests that it may exhibit interesting electronic properties, making it a candidate for studies in materials science and photochemistry. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its practical applications. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.

Formula: C₁₃H₁₁NO₂

InChI: InChI=1/C13H11NO2/c1-14-8-11(7-12(14)9-15)13(16)10-5-3-2-4-6-10/h2-9H,1H3

SMILES: Cn1cc(cc1C=O)C(=O)c1ccccc1

Synonyms:

• 1H-pyrrole-2-carboxaldehyde, 4-benzoyl-1-methyl-
• 1-methyl-4-(phenylcarbonyl)-1H-pyrrole-2-carbaldehyde

1H-PYRROLE-2-CARBOXALDEHYDE, 4-BENZOYL-1-METHYL-

CAS: 128843-58-3

Formula: C₁₃H₁₁NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 213.2319

Ref: IN-DA000YET