CAS 128843-59-4
:1-Methyl-4-(4-nitrobenzoyl)-1H-pyrrole-2-carboxaldehyde
Description:
1-Methyl-4-(4-nitrobenzoyl)-1H-pyrrole-2-carboxaldehyde is an organic compound characterized by its complex structure, which includes a pyrrole ring, a carboxaldehyde functional group, and a nitrobenzoyl substituent. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its electronic properties and reactivity. It is likely to be soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water due to its hydrophobic components. The presence of the aldehyde group suggests that it can participate in various chemical reactions, including condensation and oxidation. Additionally, the nitro group can impart unique reactivity, making this compound potentially useful in synthetic organic chemistry, particularly in the development of dyes or pharmaceuticals. Safety data should be consulted, as compounds with nitro groups can be hazardous and may require careful handling. Overall, this compound's unique structure and functional groups contribute to its potential applications in various chemical fields.
Formula:C13H10N2O4
InChI:InChI=1S/C13H10N2O4/c1-14-7-10(6-12(14)8-16)13(17)9-2-4-11(5-3-9)15(18)19/h2-8H,1H3
InChI key:InChIKey=NXKMAVMESJKNLK-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C(C=O)N(C)C1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 1-Methyl-4-(4-nitrobenzoyl)-1H-pyrrole-2-carboxaldehyde
- 1-Methyl-4-(4-nitrobenzoyl)-1H-pyrrole-2-carbaldehyde
- 1H-Pyrrole-2-carboxaldehyde, 1-methyl-4-(4-nitrobenzoyl)-
- 1-Methyl-4-(4-nitrobenzoyl)pyrrole-2-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.