CymitQuimica logo

CAS 128851-99-0

:

3-Chlorobenzo[b]thiophene-2-sulfonyl chloride

Description:
3-Chlorobenzo[b]thiophene-2-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group attached to a chlorinated benzo[b]thiophene structure. This compound typically appears as a solid and is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. It is often used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The chlorobenzothiophene moiety contributes to its unique electronic properties, making it a valuable building block in the synthesis of more complex molecules. Additionally, the compound may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Safety precautions are necessary when handling this substance, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Proper storage and handling protocols should be followed to ensure safety in laboratory environments.
Formula:C8H4Cl2O2S2
InChI:InChI=1S/C8H4Cl2O2S2/c9-7-5-3-1-2-4-6(5)13-8(7)14(10,11)12/h1-4H
InChI key:InChIKey=LITUWUFHSOPITQ-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(Cl)C=2C(S1)=CC=CC2
Synonyms:
  • Benzo[b]thiophene-2-sulfonyl chloride, 3-chloro-
  • 3-Chlorobenzo[b]thiophene-2-sulfonyl chloride
  • 3-Chloro-1-benzothiophene-2-sulfonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.