CAS 128852-06-2

Benzo[b]thiophene-7-sulfonyl chloride

Description:

Benzo[b]thiophene-7-sulfonyl chloride is an organic compound characterized by the presence of a benzo[b]thiophene moiety, which is a fused bicyclic structure containing a benzene ring and a thiophene ring. The sulfonyl chloride functional group (-SO2Cl) is attached at the 7-position of the benzo[b]thiophene, making it a sulfonating agent. This compound is typically a solid at room temperature and is known for its reactivity, particularly in nucleophilic substitution reactions, where the sulfonyl chloride can act as an electrophile. It is often used in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The presence of the sulfonyl chloride group also imparts properties such as increased polarity and potential for further functionalization. Safety precautions are necessary when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Overall, Benzo[b]thiophene-7-sulfonyl chloride is a valuable intermediate in synthetic organic chemistry.

Formula: C₈H₅ClO₂S₂

InChI: InChI=1S/C8H5ClO2S2/c9-13(10,11)7-3-1-2-6-4-5-12-8(6)7/h1-5H

InChI key: InChIKey=JOJNZADZIIGUJY-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C2C(=CC=C1)C=CS2

Synonyms:

• 1-Benzothiophene-7-sulfonyl chloride
• Benzo[b]thiophene-7-sulfonyl chloride

Benzo[b]thiophene-7-sulfonyl chloride

CAS: 128852-06-2

Formula: C₈H₅ClO₂S₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 232.7

Ref: 10-F475697