
CAS 128852-82-4
:5,6-Dichlorobenzofuran
Description:
5,6-Dichlorobenzofuran is an organic compound characterized by a benzofuran structure with two chlorine substituents at the 5 and 6 positions. This compound typically appears as a pale yellow to light brown solid and is known for its aromatic properties, which contribute to its stability and reactivity. It has a molecular formula that reflects its chlorinated nature, influencing its physical and chemical properties, such as solubility and boiling point. 5,6-Dichlorobenzofuran is often studied for its potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. Its chlorinated structure may also impart specific biological activities, making it of interest in pharmacological research. However, due to the presence of chlorine atoms, it is essential to handle this compound with care, as chlorinated compounds can exhibit toxicity and environmental persistence. Proper safety measures should be taken when working with this substance in laboratory settings.
Formula:C8H4Cl2O
InChI:InChI=1S/C8H4Cl2O/c9-6-3-5-1-2-11-8(5)4-7(6)10/h1-4H
InChI key:InChIKey=MCHGBWHBBDJKJT-UHFFFAOYSA-N
SMILES:ClC=1C=C2C(=CC1Cl)OC=C2
Synonyms:- 5,6-Dichlorobenzofuran
- Benzofuran, 5,6-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.