CAS 128854-05-7

1,6-Dihydropyrazolo[3,4-c]pyrazol-3-amine

Description:

1,6-Dihydropyrazolo[3,4-c]pyrazol-3-amine is a heterocyclic organic compound characterized by its unique pyrazolo structure, which consists of two fused pyrazole rings. This compound features an amine functional group, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. The compound's structure allows for various interactions, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its potential applications may include acting as a scaffold for drug design or as a building block in organic synthesis. The presence of nitrogen atoms in its structure can influence its electronic properties, making it a candidate for studies in coordination chemistry or as a ligand in metal complexes. As with many nitrogen-containing heterocycles, it may also exhibit interesting biological activities, warranting further investigation into its pharmacological properties.

Formula: C₄H₅N₅

InChI: InChI=1/C4H5N5/c5-3-2-1-6-8-4(2)9-7-3/h1H,(H4,5,6,7,8,9)

SMILES: c1c2c(=N)[nH][nH]c2n[nH]1

Synonyms:

• Pyrazolo[3,4-C]Pyrazol-3-Amine, 1,6-Dihydro-

Pyrazolo[3,4-c]pyrazol-3-amine, 1,6-dihydro-

CAS: 128854-05-7

Formula: C₄H₅N₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 123.1160

Ref: IN-DA000YFW

1,6-Dihydropyrazolo[3,4-c]pyrazol-3-amine

CAS: 128854-05-7

1,6-Dihydropyrazolo[3,4-c]pyrazol-3-amine

Purity: 95%

Molecular weight: 123.12g/mol

Ref: 54-OR93887

3-Amino-1,6-dihydropyrazolo[3,4-c]pyrazole

CAS: 128854-05-7

Formula: C₄H₅N₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 123.119

Ref: 10-F076320