CAS 128858-43-5
:Di-p-Chlorobenzyl N,N-Diisopropylphosphoramidite
Description:
Di-p-Chlorobenzyl N,N-Diisopropylphosphoramidite is a chemical compound characterized by its phosphoramidite structure, which is commonly used in the field of organic synthesis, particularly in the synthesis of oligonucleotides. This compound features a phosphorous atom bonded to two isopropyl groups and a p-chlorobenzyl moiety, contributing to its reactivity and stability. The presence of the p-chlorobenzyl group enhances its lipophilicity, making it suitable for various applications in medicinal chemistry and biochemistry. As a phosphoramidite, it serves as a key intermediate in the phosphorylation of nucleosides, facilitating the formation of phosphodiester bonds in nucleic acid synthesis. The compound is typically handled under anhydrous conditions due to its sensitivity to moisture, which can lead to hydrolysis. Its unique structural features and reactivity profile make it a valuable reagent in synthetic organic chemistry, particularly in the development of nucleic acid-based therapeutics and diagnostics. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C20H26Cl2NO2P
InChI:InChI=1/C20H26Cl2NO2P/c1-15(2)23(16(3)4)26(24-13-17-5-9-19(21)10-6-17)25-14-18-7-11-20(22)12-8-18/h5-12,15-16H,13-14H2,1-4H3
SMILES:CC(C)N(C(C)C)P(OCc1ccc(cc1)Cl)OCc1ccc(cc1)Cl
Synonyms:- Bis(4-Chlorobenzyl) Bis(1-Methylethyl)Amidophosphite
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Phosphoramidous acid, N,N-bis(1-methylethyl)-, bis[(4-chlorophenyl)methyl] ester
CAS:Formula:C20H26Cl2NO2PColor and Shape:SolidMolecular weight:414.3057Di-p-chlorobenzyl N,N-Diisopropylphosphoramidite
CAS:Controlled Product<p>Stability Moisture Sensitive<br>Applications A versatile phosphitylating agent for the phosphorylation of hydroxy amino acids and the preparation of protected phosphopeptides.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Liskamp, R.M.J., et al.: Recl. Trav. Chim. Pays-Bas, 109, 27 (1990)<br></p>Formula:C20H26Cl2NO2PColor and Shape:NeatMolecular weight:414.31

