CymitQuimica logo

CAS 128858-44-6

:

N,N-Bis(1-methylethyl)phosphonamidic acid

Description:
N,N-Bis(1-methylethyl)phosphonamidic acid, identified by its CAS number 128858-44-6, is a chemical compound that belongs to the class of phosphonamidic acids. This substance features a phosphorus atom bonded to two isopropyl groups and an amidic functional group, which contributes to its unique chemical properties. It is characterized by its potential use in various applications, including as a reagent in organic synthesis and possibly in agricultural chemistry due to its phosphonate structure. The presence of the phosphonamidic moiety suggests that it may exhibit biological activity, potentially influencing its behavior in environmental and biological systems. The compound is typically a colorless to pale yellow liquid, and its solubility in water can vary based on pH and temperature. Safety data should be consulted for handling and storage, as phosphonamidic compounds can exhibit toxicity and require appropriate precautions. Overall, N,N-Bis(1-methylethyl)phosphonamidic acid is a notable compound in the field of chemistry, particularly for its phosphonate characteristics and potential applications.
Formula:C6H16NO2P
InChI:InChI=1S/C6H16NO2P/c1-5(2)7(6(3)4)10(8)9/h5-6,10H,1-4H3,(H,8,9)
InChI key:InChIKey=CRVVOJKQVNWWCP-UHFFFAOYSA-N
SMILES:N(C(C)C)(C(C)C)P(=O)O
Synonyms:
  • Phosphonamidic acid, N,N-bis(1-methylethyl)-
  • N,N-Bis(1-methylethyl)phosphonamidic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.