CAS 128879-80-1
:O-aminophthalylhydrazido-N-acetyl-B-D-*glucosamin
Description:
O-aminophthalylhydrazido-N-acetyl-B-D-glucosamin, with the CAS number 128879-80-1, is a chemical compound that features a complex structure incorporating both hydrazine and glucosamine moieties. This compound is characterized by the presence of an amino group attached to a phthalyl group, which is linked to a hydrazido group, and further connected to an N-acetyl derivative of β-D-glucosamine. The presence of these functional groups suggests potential applications in biochemical research, particularly in the study of glycosylation processes and enzyme interactions. The hydrazido linkage may also indicate reactivity that could be exploited in synthetic chemistry or medicinal chemistry. Additionally, the N-acetyl group contributes to the compound's solubility and stability in biological systems. Overall, this compound's unique structural features make it a subject of interest for further investigation in various fields, including organic synthesis, pharmacology, and biochemistry.
Formula:C16H20N4O7
InChI:InChI=1/C16H20N4O7/c1-6(22)18-11-13(24)12(23)9(5-21)26-16(11)27-15-10-7(14(25)19-20-15)3-2-4-8(10)17/h2-4,9,11-13,16,21,23-24H,5,17H2,1H3,(H,18,22)(H,19,25)/t9-,11-,12-,13-,16+/m1/s1
Synonyms:- 2-Aminophthalylhydrazido-N-Acetyl-b-D-Glucosaminide
- 8-amino-4-oxo-3,4-dihydrophthalazin-1-yl 2-(acetylamino)-2-deoxy-beta-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1(2H)-Phthalazinone, 4-[[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]oxy]-5(or 8)-amino- (9CI)
CAS:Formula:C16H20N4O7Color and Shape:SolidMolecular weight:380.3526N-Acetyl-2-aminophthalylhydrazido-β-D-glucosaminide
CAS:N-Acetyl-2-aminophthalylhydrazido-β-D-glucosaminidePurity:≥95%(2-Aminophthalylhydrazido) 2-acetamido-2-deoxy-b-D-glucopyranoside
CAS:2-Aminophthalylhydrazido 2-acetamido-2-deoxy-b-D-glucopyranoside is a chromogenic substrate that is used as a diagnostic in biological research. It reacts with enzymes to form fluorescent products, and can be used to detect the presence of bacteria and fungi. This product has a CAS number of 128879-80-1 and can be used for food testing, environmental testing, or bioluminescence. It is an important component in the development of new antibiotics.
Formula:C16H20N4O7Purity:Min. 95%Molecular weight:380.35 g/mol




