CAS 128885-13-2
:8-O-methyl-7,9-di-O-acetyl-N-glycolylneuraminic acid
Description:
8-O-Methyl-7,9-di-O-acetyl-N-glycolylneuraminic acid, with the CAS number 128885-13-2, is a derivative of sialic acid, which is a family of nine-carbon sugars known for their role in cellular recognition and signaling. This compound features multiple acetyl groups, which enhance its stability and solubility, and a methyl group that modifies its reactivity and interaction with biological systems. The presence of the glycolyl group contributes to its unique properties, potentially influencing its biological activity and interactions with receptors. As a sialic acid derivative, it may play a role in various biochemical processes, including cell adhesion and immune response modulation. Its structural modifications can affect its binding affinity to lectins and other proteins, making it of interest in glycoscience and potential therapeutic applications. Overall, this compound exemplifies the complexity and versatility of carbohydrate chemistry, particularly in the context of biological functions and medicinal chemistry.
Formula:C16H25NO12
InChI:InChI=1/C16H25NO12/c1-7(19)28-6-11(27-3)15(29-8(2)20)14(24)13(17-12(23)5-18)9(21)4-10(22)16(25)26/h9,11,13-15,18,21,24H,4-6H2,1-3H3,(H,17,23)(H,25,26)/t9-,11+,13+,14+,15+/m0/s1
Synonyms:- 3,5-Dideoxy-5-((hydroxyacetyl)amino)-8-O-methyl-D-glycero-D-galacto-2-nonulosonic acid 7,9-diacetate
- 8-O-Me-7,9-di-O-Nac-gcneu
- Mafn
- D-glycero-D-galacto-2-Nonulosonic acid, 3,5-dideoxy-5-((hydroxyacetyl)amino)-8-O-methyl-, 7,9-diacetate
- 7,9-di-O-acetyl-3,5-dideoxy-5-[(hydroxyacetyl)amino]-8-O-methyl-D-glycero-D-galacto-non-2-ulosonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
7,9-Di-O-acetyl-N-glycolyl-8-O-methylneuraminic acid
CAS:7,9-Di-O-acetyl-N-glycolyl-8-O-methylneuraminic acid is a synthetic glycolylneuraminic acid analogue that can be used in the treatment of bacterial infections. It is a prodrug that is converted to glycolylneuraminic acid by monoclonal antibody and other enzymes. 7,9-Di-O-acetyl-N-glycolyl-8-O-methylneuraminic acid inhibits the activity of necrosis factor (TNF) by binding to its receptor, thereby preventing TNF from binding to cells and stimulating inflammation. This compound has been shown to be effective against many bacteria including methicillin resistant Staphylococcus aureus (MRSA). Techniques used for the synthesis include high performance liquid chromatography with mass spectrometry detection and cavity ring down spectroscopy.Formula:C16H25NO12Purity:Min. 95%Molecular weight:423.37 g/mol
