CymitQuimica logo

CAS 128887-33-2

:

5-fluoro-1-(4-methoxy-3-nitro-phenyl)sulfonyl-pyrimidine-2,4-dione

Description:
5-Fluoro-1-(4-methoxy-3-nitro-phenyl)sulfonyl-pyrimidine-2,4-dione, with the CAS number 128887-33-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrimidine ring substituted with a sulfonyl group and various functional groups. This compound typically exhibits properties such as moderate solubility in polar organic solvents and potential reactivity due to the presence of the sulfonyl and nitro groups. The fluorine atom contributes to its electronic properties, potentially enhancing its biological activity. The methoxy and nitro substituents on the phenyl ring can influence its chemical reactivity and interaction with biological targets. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The presence of multiple functional groups suggests that it may participate in various chemical reactions, making it a subject of interest in medicinal chemistry and drug design.
Formula:C11H8FN3O7S
InChI:InChI=1/C11H8FN3O7S/c1-22-9-3-2-6(4-8(9)15(18)19)23(20,21)14-5-7(12)10(16)13-11(14)17/h2-5H,1H3,(H,13,16,17)
SMILES:COc1ccc(cc1N(=O)=O)S(=O)(=O)n1cc(c(nc1=O)O)F
Synonyms:
  • 2,4(1H,3H)-Pyrimidinedione, 5-fluoro-1-((4-methoxy-3-nitrophenyl)sulfonyl)-
  • 5-Fluoro-1-((4-methoxy-3-nitrophenyl)sulfonyl)-2,4(1H,3H)-pyrimidinedione
  • 5-fluoro-1-[(4-methoxy-3-nitrophenyl)sulfonyl]pyrimidine-2,4(1H,3H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.