CAS 128889-75-8
:2,2-Dimethyl-5-[[(1-methylethyl)thio]methylene]-1,3-dioxane-4,6-dione
Description:
2,2-Dimethyl-5-[[(1-methylethyl)thio]methylene]-1,3-dioxane-4,6-dione, with CAS number 128889-75-8, is a synthetic organic compound characterized by its unique structural features, including a dioxane ring and a thioether functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the dioxane moiety contributes to its potential reactivity, particularly in nucleophilic substitution reactions. Additionally, the thioether group may enhance its stability and influence its interaction with other chemical species. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2,2-Dimethyl-5-[[(1-methylethyl)thio]methylene]-1,3-dioxane-4,6-dione represents a versatile compound with intriguing chemical properties.
Formula:C10H14O4S
InChI:InChI=1S/C10H14O4S/c1-6(2)15-5-7-8(11)13-10(3,4)14-9(7)12/h5-6H,1-4H3
InChI key:InChIKey=WMAJNWXVXWVGIQ-UHFFFAOYSA-N
SMILES:C(SC(C)C)=C1C(=O)OC(C)(C)OC1=O
Synonyms:- 2,2-Dimethyl-5-[[(1-methylethyl)thio]methylene]-1,3-dioxane-4,6-dione
- 1,3-Dioxane-4,6-dione, 2,2-dimethyl-5-[[(1-methylethyl)thio]methylene]-
- 2,2-Dimethyl-5-[(propan-2-ylsulfanyl)methylidene]-1,3-dioxane-4,6-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.