
CAS 1288994-61-5
:3-Bromo-4-(4-piperidinyloxy)pyridine
Description:
3-Bromo-4-(4-piperidinyloxy)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 3-position with a bromine atom and at the 4-position with a piperidinyloxy group. This structure imparts unique properties, including potential biological activity, making it of interest in medicinal chemistry. The presence of the piperidine moiety suggests that the compound may interact with various biological targets, possibly influencing neurotransmitter systems or exhibiting pharmacological effects. The bromine atom enhances the compound's reactivity and may facilitate further chemical modifications. Additionally, the compound's solubility and stability can be influenced by the functional groups present, which are critical for its application in drug development or as a research tool. Overall, 3-Bromo-4-(4-piperidinyloxy)pyridine represents a versatile scaffold for exploring new therapeutic agents, particularly in the context of neurological research or other fields where pyridine derivatives are relevant.
Formula:C10H13BrN2O
InChI:InChI=1S/C10H13BrN2O/c11-9-7-13-6-3-10(9)14-8-1-4-12-5-2-8/h3,6-8,12H,1-2,4-5H2
InChI key:InChIKey=OBCZNEZQEORUGT-UHFFFAOYSA-N
SMILES:O(C=1C(Br)=CN=CC1)C2CCNCC2
Synonyms:- Pyridine, 3-bromo-4-(4-piperidinyloxy)-
- 3-Bromo-4-(4-piperidinyloxy)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.