CAS 1289007-85-7
:5-Bromo-3-fluoro-2-(methylthio)pyridine
Description:
5-Bromo-3-fluoro-2-(methylthio)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and fluorine substituents at the 5 and 3 positions, respectively, contributes to its reactivity and potential applications in various chemical reactions. The methylthio group at the 2 position enhances its nucleophilicity and can influence its biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in organic solvents. It may exhibit interesting properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Additionally, the presence of halogens can affect its electronic properties, making it useful in synthetic chemistry for the development of more complex molecules. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks.
Formula:C6H5BrFNS
InChI:InChI=1S/C6H5BrFNS/c1-10-6-5(8)2-4(7)3-9-6/h2-3H,1H3
InChI key:InChIKey=CYINFPXUZWAGDM-UHFFFAOYSA-N
SMILES:S(C)C1=C(F)C=C(Br)C=N1
Synonyms:- 5-Bromo-3-fluoro-2-(methylthio)pyridine
- Pyridine, 5-bromo-3-fluoro-2-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.