CAS 128903-21-9
:2,2-Dichloro-1,1,1,3,3-pentafluoropropane
Description:
2,2-Dichloro-1,1,1,3,3-pentafluoropropane, with the CAS number 128903-21-9, is a halogenated organic compound primarily used as a refrigerant and in various industrial applications. This substance is characterized by its molecular structure, which includes two chlorine atoms and five fluorine atoms attached to a propane backbone. It is a colorless gas or liquid at room temperature, exhibiting low toxicity and non-flammability, making it suitable for specific applications where safety is a concern. The presence of multiple fluorine atoms contributes to its high stability and low reactivity, while the chlorine atoms can influence its environmental impact, particularly in terms of ozone depletion potential. Additionally, 2,2-Dichloro-1,1,1,3,3-pentafluoropropane has a relatively low global warming potential compared to other refrigerants, aligning with current trends towards more environmentally friendly alternatives. Its physical properties, such as boiling point and vapor pressure, are essential for its use in refrigeration systems and other applications.
Formula:C3HCl2F5
InChI:InChI=1S/C3HCl2F5/c4-2(5,1(6)7)3(8,9)10/h1H
InChI key:InChIKey=JEWUXLHWYRSHJK-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C(F)F)(Cl)Cl
Synonyms:- 1,1,1,3,3-Pentafluoro-2,2-dichloropropane
- 2,2-Dichloro-1,1,1,3,3-pentafluoropropane
- 2,2-Dichloro-1,1,3,3,3-pentafluoropropane
- HCFC 225aa
- Propane, 2,2-dichloro-1,1,1,3,3-pentafluoro-
- R 225aa
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
