
CAS 1289042-69-8
:2-(Dimethylamino)-5-iodobenzaldehyde
Description:
2-(Dimethylamino)-5-iodobenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a dimethylamino substituent. The presence of iodine at the 5-position of the benzene ring enhances its reactivity, making it useful in various chemical reactions, including electrophilic substitutions. This compound typically appears as a solid at room temperature and is soluble in organic solvents. Its dimethylamino group contributes to its basicity and potential as a nucleophile in chemical synthesis. The compound is of interest in medicinal chemistry and materials science due to its potential applications in the development of pharmaceuticals and dyes. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and respiratory system. Proper storage in a cool, dry place away from light is recommended to maintain its stability and integrity.
Formula:C9H10INO
InChI:InChI=1S/C9H10INO/c1-11(2)9-4-3-8(10)5-7(9)6-12/h3-6H,1-2H3
InChI key:InChIKey=PTNLGQILYUHBIC-UHFFFAOYSA-N
SMILES:C(=O)C1=C(N(C)C)C=CC(I)=C1
Synonyms:- Benzaldehyde, 2-(dimethylamino)-5-iodo-
- 2-(Dimethylamino)-5-iodobenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.