CAS 1289083-13-1

7-Chloro-3-methylimidazo[1,2-a]pyridine

Description:

7-Chloro-3-methylimidazo[1,2-a]pyridine is a heterocyclic aromatic compound characterized by its fused imidazole and pyridine rings, with a chlorine substituent at the 7-position and a methyl group at the 3-position. This compound is of interest in the field of toxicology and carcinogenicity, as it is a derivative of imidazoquinoline, which has been studied for its potential role as a mutagen. The presence of the chlorine atom can influence the compound's reactivity and biological interactions. It is typically synthesized through specific organic reactions involving precursors that contain the requisite nitrogen and carbon frameworks. The compound's structure contributes to its properties, including solubility and stability, which can vary depending on the solvent and environmental conditions. Due to its potential biological activity, 7-Chloro-3-methylimidazo[1,2-a]pyridine is often analyzed in studies related to food safety, particularly in cooked meats, where it can form during the cooking process of amino acids and creatine at high temperatures.

Formula: C₈H₇ClN₂

InChI: InChI=1S/C8H7ClN2/c1-6-5-10-8-4-7(9)2-3-11(6)8/h2-5H,1H3

InChI key: InChIKey=IVWWUYHTCLDWKJ-UHFFFAOYSA-N

SMILES: CC=1N2C(=NC1)C=C(Cl)C=C2

Synonyms:

• Imidazo[1,2-a]pyridine, 7-chloro-3-methyl-
• 7-Chloro-3-methylimidazo[1,2-a]pyridine