CAS 1289120-93-9

8-Bromo-6-chloroimidazo[1,2-a]pyrazin-3-amine

Description:

8-Bromo-6-chloroimidazo[1,2-a]pyrazin-3-amine is a heterocyclic organic compound characterized by its complex structure, which includes both bromine and chlorine substituents on an imidazo[1,2-a]pyrazine core. This compound features a fused bicyclic system that contributes to its unique chemical properties. The presence of the bromine and chlorine atoms typically enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The amine functional group indicates that it can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological activities, including antimicrobial or anticancer properties. Additionally, the specific arrangement of atoms and functional groups can affect its electronic properties, making it suitable for applications in materials science or as a building block in organic synthesis. Overall, 8-Bromo-6-chloroimidazo[1,2-a]pyrazin-3-amine exemplifies the complexity and versatility of heterocyclic compounds in chemical research.

Formula: C₆H₄BrClN₄

InChI: InChI=1S/C6H4BrClN4/c7-5-6-10-1-4(9)12(6)2-3(8)11-5/h1-2H,9H2

InChI key: InChIKey=SYCLFBYNFSGHPS-UHFFFAOYSA-N

SMILES: BrC=1C=2N(C=C(Cl)N1)C(N)=CN2

Synonyms:

• Imidazo[1,2-a]pyrazin-3-amine, 8-bromo-6-chloro-
• 8-Bromo-6-chloroimidazo[1,2-a]pyrazin-3-amine