CymitQuimica logo

CAS 1289121-44-3

:

6-Chloro-4-iodo-3-pyridinecarboxaldehyde

Description:
6-Chloro-4-iodo-3-pyridinecarboxaldehyde is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of both chlorine and iodine substituents at the 6 and 4 positions, respectively, introduces significant reactivity and influences its chemical properties. The aldehyde functional group (-CHO) at the 3-position contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit polar characteristics due to the electronegative halogen atoms and the aldehyde group, which can affect its solubility in different solvents. Additionally, the presence of halogens can impart unique biological activities, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C6H3ClINO
InChI:InChI=1S/C6H3ClINO/c7-6-1-5(8)4(3-10)2-9-6/h1-3H
InChI key:InChIKey=HVSXGKVQNFOUNV-UHFFFAOYSA-N
SMILES:C(=O)C=1C(I)=CC(Cl)=NC1
Synonyms:
  • 6-Chloro-4-iodo-3-pyridinecarboxaldehyde
  • 3-Pyridinecarboxaldehyde, 6-chloro-4-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.