
CAS 1289141-90-7
:B-(1-Ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)boronic acid
Description:
B-(1-Ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrrolopyridine moiety. This compound typically exhibits properties such as being a white to off-white solid, with solubility in polar organic solvents due to the presence of the boronic acid group. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as boronic acids can act as important intermediates in the synthesis of biologically active compounds. The presence of the pyrrolopyridine structure may contribute to its biological activity, possibly influencing interactions with biological targets. Additionally, boronic acids are known for their ability to form reversible covalent bonds with diols, which can be exploited in various chemical reactions and sensing applications. Safety data and handling precautions should be observed, as with all chemical substances, to ensure safe laboratory practices.
Formula:C9H11BN2O2
InChI:InChI=1S/C9H11BN2O2/c1-2-12-4-3-7-5-8(10(13)14)6-11-9(7)12/h3-6,13-14H,2H2,1H3
InChI key:InChIKey=KKHRKFZWQBPYGY-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(=CC(B(O)O)=CN2)C=C1
Synonyms:- B-(1-Ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)boronic acid
- [1-Ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl]boronic acid
- 1-Ethyl-1H-pyrrolo[2,3-b]pyridin-5-ylboronic acid
- Boronic acid, B-(1-ethyl-1H-pyrrolo[2,3-b]pyridin-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
