CymitQuimica logo

CAS 128915-82-2

:

N-[2-(2-aminoethyldisulfanyl)ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide

Description:
N-[2-(2-aminoethyldisulfanyl)ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide, with CAS number 128915-82-2, is a complex organic compound characterized by its unique structural features, including a thieno[3,4-d]imidazole moiety and a disulfide linkage. This compound contains multiple functional groups, such as amides and amino groups, which contribute to its potential biological activity. The presence of the thienoimidazole structure suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its disulfide bond may play a role in redox chemistry and protein interactions, potentially influencing its pharmacological properties. The stereochemistry indicated by the (4S) designation suggests specific spatial arrangements that could affect the compound's reactivity and biological efficacy. Overall, this compound's intricate structure and functional diversity position it as a candidate for further research in drug development and therapeutic applications.
Formula:C14H26N4O2S3
InChI:InChI=1/C14H26N4O2S3/c15-5-7-22-23-8-6-16-12(19)4-2-1-3-11-13-10(9-21-11)17-14(20)18-13/h10-11,13H,1-9,15H2,(H,16,19)(H2,17,18,20)/t10?,11-,13?/m0/s1
SMILES:C(CCC(=NCCSSCCN)O)C[C@H]1C2C(CS1)N=C(N2)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.