
CAS 128915-84-4
:1,4-Dibromo-2,5-dibutoxybenzene
Description:
1,4-Dibromo-2,5-dibutoxybenzene is an organic compound characterized by its brominated aromatic structure and the presence of butoxy groups. It features two bromine atoms attached to the benzene ring at the 1 and 4 positions, while two butoxy groups are located at the 2 and 5 positions. This compound is typically a solid at room temperature and may exhibit a moderate to high melting point due to the presence of the bromine atoms, which increase molecular weight and intermolecular interactions. The butoxy groups contribute to its solubility in organic solvents, while the bromine substituents can enhance reactivity in various chemical reactions, such as nucleophilic substitutions. 1,4-Dibromo-2,5-dibutoxybenzene may be used in organic synthesis and materials science, particularly in the development of polymers or as intermediates in the synthesis of more complex molecules. Safety data should be consulted, as brominated compounds can pose health risks, including potential toxicity and environmental concerns.
Formula:C14H20Br2O2
InChI:InChI=1S/C14H20Br2O2/c1-3-5-7-17-13-9-12(16)14(10-11(13)15)18-8-6-4-2/h9-10H,3-8H2,1-2H3
InChI key:InChIKey=XCQQVOXIIWKRLJ-UHFFFAOYSA-N
SMILES:O(CCCC)C1=C(Br)C=C(OCCCC)C(Br)=C1
Synonyms:- 1,4-Dibromo-2,5-dibutoxybenzene
- Benzene, 1,4-dibromo-2,5-dibutoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
