CAS 1289187-99-0

6-Bromo-N-methyl-3-nitro-4-quinolinamine

Description:

6-Bromo-N-methyl-3-nitro-4-quinolinamine is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. The presence of a bromine atom at the 6-position and a nitro group at the 3-position contributes to its reactivity and potential applications in various fields, including medicinal chemistry and materials science. The N-methyl group enhances its solubility and may influence its biological activity. This compound is likely to exhibit properties typical of nitro-substituted aromatic compounds, such as potential antibacterial or anticancer activities, although specific biological effects would depend on further empirical studies. Additionally, the presence of halogen and nitro groups can affect the compound's electronic properties, making it a candidate for further research in drug development or as a synthetic intermediate. Safety and handling precautions should be observed due to the potential toxicity associated with nitro and halogenated compounds.

Formula: C₁₀H₈BrN₃O₂

InChI: InChI=1S/C10H8BrN3O2/c1-12-10-7-4-6(11)2-3-8(7)13-5-9(10)14(15)16/h2-5H,1H3,(H,12,13)

InChI key: InChIKey=CVKSJBKEXLNKLZ-UHFFFAOYSA-N

SMILES: N(C)C=1C2=C(N=CC1N(=O)=O)C=CC(Br)=C2

Synonyms:

• 4-Quinolinamine, 6-bromo-N-methyl-3-nitro-
• 6-Bromo-N-methyl-3-nitro-4-quinolinamine