CAS 128923-28-4
:1-O-[(5-chloro-1,3,3a,12b-tetrahydro-2H-dibenzo[2,3:6,7]oxepino[4,5-c]pyrrol-2-yl)carbonyl]-beta-D-glucopyranuronic acid
Description:
1-O-[(5-chloro-1,3,3a,12b-tetrahydro-2H-dibenzo[2,3:6,7]oxepino[4,5-c]pyrrol-2-yl)carbonyl]-beta-D-glucopyranuronic acid is a complex organic compound characterized by its unique structural features, which include a glucopyranuronic acid moiety linked to a chlorinated dibenzo-oxepine-pyrrole derivative. This compound exhibits properties typical of both carbohydrate and heterocyclic chemistry, suggesting potential biological activity. The presence of the chloro substituent may influence its reactivity and interaction with biological targets. The glucopyranuronic acid component indicates potential solubility in aqueous environments, while the larger, more hydrophobic dibenzo-oxepine structure may contribute to lipophilicity. Such compounds are often investigated for their pharmacological properties, including potential anti-inflammatory or anticancer activities. The specific stereochemistry and functional groups present in the molecule can significantly affect its biological interactions and therapeutic potential. Overall, this compound represents a fascinating intersection of carbohydrate chemistry and complex organic synthesis, warranting further exploration in medicinal chemistry and drug development.
Formula:C23H22ClNO9
InChI:InChI=1/C23H22ClNO9/c24-10-5-6-16-12(7-10)14-9-25(8-13(14)11-3-1-2-4-15(11)32-16)23(31)34-22-19(28)17(26)18(27)20(33-22)21(29)30/h1-7,13-14,17-20,22,26-28H,8-9H2,(H,29,30)/t13?,14?,17-,18-,19+,20-,22-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-Desmethyl Asenapine N-Carbamoyl Glucuronide
CAS:Controlled ProductFormula:C23H22ClNO9Color and Shape:NeatMolecular weight:491.875

