CAS 1289384-93-5

Piperidine, 3-[[(3,4-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[[[3,4-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a 3,4-dichlorophenyl group indicates that the compound has significant aromatic characteristics, contributing to its potential biological activity. The methoxy group attached to the phenyl ring enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as analgesic or psychoactive effects, depending on its interaction with biological systems. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise molecular structure and the presence of functional groups. Safety data and handling precautions are essential due to the potential toxicity associated with chlorinated aromatic compounds.

Formula: C₁₃H₁₇Cl₂NO·ClH

InChI: InChI=1S/C13H17Cl2NO.ClH/c14-12-4-3-10(6-13(12)15)8-17-9-11-2-1-5-16-7-11;/h3-4,6,11,16H,1-2,5,7-9H2;1H

InChI key: InChIKey=WCVBTLKWNWHQJU-UHFFFAOYSA-N

SMILES: C(OCC1CCCNC1)C2=CC(Cl)=C(Cl)C=C2.Cl

Synonyms:

• Piperidine, 3-[[(3,4-dichlorophenyl)methoxy]methyl]-, hydrochloride (1:1)