CAS 1289384-96-8: 2-Piperazinecarboxylic acid, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:1)

Description:2-Piperazinecarboxylic acid, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a 4-chlorobenzyl substituent that enhances its lipophilicity and potential biological activity. The hydrochloride form indicates that the compound is a salt, which typically improves its solubility in water and stability. This substance may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its structure suggests potential interactions with neurotransmitter systems, given the presence of the piperazine moiety, which is often found in psychoactive compounds. As with many chemical substances, safety and handling precautions are essential, as the compound may pose health risks if not managed properly. Further studies would be necessary to elucidate its specific biological activities and therapeutic potential.

Formula:C₁₂H₁₅ClN₂O₂·ClH

InChI:InChI=1S/C12H15ClN2O2.ClH/c13-10-3-1-9(2-4-10)8-15-6-5-14-7-11(15)12(16)17;/h1-4,11,14H,5-8H2,(H,16,17);1H

InChI key:InChIKey=FSMFSTPHIQDJRR-UHFFFAOYSA-N

SMILES:Cl.O=C(O)C1N(CC2=CC=C(Cl)C=C2)CCNC1

Synonyms:
2-Piperazinecarboxylic acid, 1-[(4-chlorophenyl)methyl]-, hydrochloride (1:1)

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	1-(4-Chloro-benzyl)-piperazine-2-carboxylic acid hydrochloride REF: 10-F090509CAS: 1289384-96-8	- - -	- - -	Discontinued product
	1-(4-Chloro-benzyl)-piperazine-2-carboxylic acid hydrochloride REF: 3D-PBC38496CAS: 1289384-96-8	Min. 95%	- - -	Discontinued product