CAS 1289385-01-8

2-Piperazinecarboxylic acid, 1-[(6-chloro-3-pyridinyl)methyl]-, (6-chloro-3-pyridinyl)methyl ester, hydrochloride (1:1)

Description:

2-Piperazinecarboxylic acid, 1-[(6-chloro-3-pyridinyl)methyl]-, (6-chloro-3-pyridinyl)methyl ester, hydrochloride (1:1) is a chemical compound characterized by its piperazine and pyridine moieties, which contribute to its biological activity and potential pharmacological properties. The presence of the chloro substituent on the pyridine ring enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically encountered as a hydrochloride salt, which improves its solubility in aqueous environments, making it suitable for various applications in medicinal chemistry. The piperazine ring is known for its role in drug design, often associated with central nervous system activity. The ester functional group suggests potential reactivity, which could be exploited in further chemical modifications or in the synthesis of prodrugs. Overall, this compound's structural features indicate its potential utility in pharmaceutical research, particularly in the development of therapeutics targeting specific receptors or enzymes. However, detailed studies on its pharmacodynamics and pharmacokinetics would be necessary to fully understand its biological implications.

Formula: C₁₇H₁₈Cl₂N₄O₂·ClH

InChI: InChI=1S/C17H18Cl2N4O2.ClH/c18-15-3-1-12(7-21-15)10-23-6-5-20-9-14(23)17(24)25-11-13-2-4-16(19)22-8-13;/h1-4,7-8,14,20H,5-6,9-11H2;1H

InChI key: InChIKey=DTIXAKQHFWISIE-UHFFFAOYSA-N

SMILES: C(OCC=1C=CC(Cl)=NC1)(=O)C2N(CC=3C=CC(Cl)=NC3)CCNC2.Cl

Synonyms:

• 2-Piperazinecarboxylic acid, 1-[(6-chloro-3-pyridinyl)methyl]-, (6-chloro-3-pyridinyl)methyl ester, hydrochloride (1:1)