CAS 1289385-05-2

1,1-Dimethylethyl 3-[(1-methylethyl)amino]-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(1-methylethyl)amino]-1-pyrrolidinecarboxylate, identified by its CAS number 1289385-05-2, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and an isopropylamino substituent, indicating it has branched alkyl groups that contribute to its steric properties. The carboxylate functional group suggests potential for reactivity, particularly in esterification or amidation reactions. Its molecular structure implies that it may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. The presence of nitrogen in the pyrrolidine ring can also influence its basicity and solubility in various solvents. Overall, this compound's unique structural features may lead to diverse applications in chemical synthesis and pharmaceutical development, although specific biological activities would require further investigation through empirical studies.

Formula: C₁₂H₂₄N₂O₂

InChI: InChI=1S/C12H24N2O2/c1-9(2)13-10-6-7-14(8-10)11(15)16-12(3,4)5/h9-10,13H,6-8H2,1-5H3

InChI key: InChIKey=JRECQALUKGSSFA-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(NC(C)C)CC1

Synonyms:

• 1,1-Dimethylethyl 3-[(1-methylethyl)amino]-1-pyrrolidinecarboxylate
• 1-Pyrrolidinecarboxylic acid, 3-[(1-methylethyl)amino]-, 1,1-dimethylethyl ester

3-Isopropylamino-pyrrolidine-1-carboxylic acid tert-butyl ester

CAS: 1289385-05-2

Formula: C₁₂H₂₄N₂O₂

Purity: 97%

Molecular weight: 228.336

Ref: 10-F088318