CAS 1289385-09-6

2-(1-Chloroethyl)-1H-pyrrole

Description:

2-(1-Chloroethyl)-1H-pyrrole is an organic compound characterized by its pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. The presence of a chloroethyl group at the 2-position of the pyrrole ring introduces both alkyl and halogen functionalities, which can influence its reactivity and solubility. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is expected to exhibit moderate polarity due to the electronegative chlorine atom, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. The compound may also show biological activity, making it of interest in medicinal chemistry and agrochemical applications. Safety considerations are important, as halogenated compounds can be toxic or hazardous. Proper handling and storage in a controlled environment are essential to mitigate risks associated with exposure. Overall, 2-(1-Chloroethyl)-1H-pyrrole is a versatile compound with potential applications in various chemical synthesis and research fields.

Formula: C₆H₈ClN

InChI: InChI=1S/C6H8ClN/c1-5(7)6-3-2-4-8-6/h2-5,8H,1H3

InChI key: InChIKey=JGAQLFTWGFGENK-UHFFFAOYSA-N

SMILES: C(C)(Cl)C1=CC=CN1

Synonyms:

• 2-(1-Chloroethyl)-1H-pyrrole
• 1H-Pyrrole, 2-(1-chloroethyl)-