CAS 1289385-10-9

trans-4-(2-Pyrazinylamino)cyclohexanol

Description:

Trans-4-(2-Pyrazinylamino)cyclohexanol is a chemical compound characterized by its unique structural features, which include a cyclohexanol ring and a pyrazinylamino group. The trans configuration indicates that the substituents on the cyclohexanol are positioned opposite each other, influencing its stereochemistry and potentially its biological activity. This compound may exhibit properties typical of both alcohols and amines, such as hydrogen bonding capabilities, which can affect its solubility and reactivity. The presence of the pyrazine ring, a heterocyclic aromatic compound, suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may contribute to specific pharmacological properties, including potential use in drug development. Additionally, the compound's CAS number, 1289385-10-9, provides a unique identifier for regulatory and research purposes. Overall, trans-4-(2-Pyrazinylamino)cyclohexanol represents a compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₀H₁₅N₃O

InChI: InChI=1/C10H15N3O/c14-9-3-1-8(2-4-9)13-10-7-11-5-6-12-10/h5-9,14H,1-4H2,(H,12,13)/t8-,9-

InChI key: InChIKey=GNZAYWUVFODBKK-KYZUINATNA-N

SMILES: N([C@H]1CC[C@H](O)CC1)C=2C=NC=CN2

Synonyms:

• Cyclohexanol, 4-(2-pyrazinylamino)-, trans-
• trans-4-(2-Pyrazinylamino)cyclohexanol

(1R,4R)-4-[(Pyrazin-2-yl)amino]cyclohexan-1-ol

CAS: 1289385-10-9

Versatile small molecule scaffold

Formula: C₁₀H₁₅N₃O

Purity: Min. 95%

Molecular weight: 193.25 g/mol

Ref: 3D-PBC38510