
CAS 1289385-14-3
:2,4-Dichloro-6-(ethoxymethyl)pyrimidine
Description:
2,4-Dichloro-6-(ethoxymethyl)pyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of two chlorine atoms at the 2 and 4 positions of the ring contributes to its reactivity and potential applications in various chemical reactions. The ethoxymethyl group at the 6 position enhances its solubility and may influence its biological activity. This compound is typically used in the synthesis of pharmaceuticals and agrochemicals, owing to its ability to act as a building block in the development of more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 2,4-Dichloro-6-(ethoxymethyl)pyrimidine is a versatile compound with significant implications in chemical research and industry.
Formula:C7H8Cl2N2O
InChI:InChI=1S/C7H8Cl2N2O/c1-2-12-4-5-3-6(8)11-7(9)10-5/h3H,2,4H2,1H3
InChI key:InChIKey=LAKFUTVFNIDEAC-UHFFFAOYSA-N
SMILES:C(OCC)C=1C=C(Cl)N=C(Cl)N1
Synonyms:- Pyrimidine, 2,4-dichloro-6-(ethoxymethyl)-
- 2,4-Dichloro-6-(ethoxymethyl)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.