CAS 1289385-17-6

2-Pyridinamine, 6-bromo-N-3-pyrrolidinyl-, hydrochloride (1:1)

Description:

2-Pyridinamine, 6-bromo-N-3-pyrrolidinyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and pyrrolidine moieties, which contribute to its biological activity and potential applications in medicinal chemistry. The presence of a bromine atom at the 6-position of the pyridine ring enhances its reactivity and may influence its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various formulations. This compound may exhibit properties such as being a potential ligand for biological targets, and its structure suggests possible interactions with neurotransmitter systems. The specific arrangement of functional groups allows for diverse chemical reactivity, making it a candidate for further research in drug development. Safety and handling precautions should be observed due to the presence of halogenated compounds, which can pose environmental and health risks. Overall, 2-Pyridinamine, 6-bromo-N-3-pyrrolidinyl-, hydrochloride is of interest in the fields of organic synthesis and pharmacology.

Formula: C₉H₁₂BrN₃·ClH

InChI: InChI=1S/C9H12BrN3.ClH/c10-8-2-1-3-9(13-8)12-7-4-5-11-6-7;/h1-3,7,11H,4-6H2,(H,12,13);1H

InChI key: InChIKey=GGKOUMXCDBNZFO-UHFFFAOYSA-N

SMILES: N(C=1N=C(Br)C=CC1)C2CCNC2.Cl

Synonyms:

• 2-Pyridinamine, 6-bromo-N-3-pyrrolidinyl-, hydrochloride (1:1)