CAS 1289385-20-1
:1-[(2-Chloro-5-thiazolyl)methyl]-2-piperidinemethanol
Description:
1-[(2-Chloro-5-thiazolyl)methyl]-2-piperidinemethanol is a chemical compound characterized by its unique structural features, which include a piperidine ring and a thiazole moiety. The presence of the chloro group on the thiazole ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in polar solvents due to the hydroxyl group (-OH) in its structure. Its molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often demonstrate significant biological activity. The thiazole ring is known for its role in various biological processes, and the piperidine ring can influence the compound's pharmacokinetics and pharmacodynamics. Overall, 1-[(2-Chloro-5-thiazolyl)methyl]-2-piperidinemethanol represents a class of compounds that may be of interest for further research in drug discovery and development.
Formula:C10H15ClN2OS
InChI:InChI=1S/C10H15ClN2OS/c11-10-12-5-9(15-10)6-13-4-2-1-3-8(13)7-14/h5,8,14H,1-4,6-7H2
InChI key:InChIKey=ZSWXNYVFPJGVFV-UHFFFAOYSA-N
SMILES:C(N1C(CO)CCCC1)C2=CN=C(Cl)S2
Synonyms:- 2-Piperidinemethanol, 1-[(2-chloro-5-thiazolyl)methyl]-
- 1-[(2-Chloro-5-thiazolyl)methyl]-2-piperidinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.