CymitQuimica logo

CAS 1289385-23-4

:

2-[(trans-4-Hydroxycyclohexyl)amino]-3-pyridinecarbonitrile

Description:
2-[(trans-4-Hydroxycyclohexyl)amino]-3-pyridinecarbonitrile, identified by its CAS number 1289385-23-4, is a chemical compound characterized by its unique structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, and a cyano group (-C≡N) that contributes to its reactivity and potential applications in various chemical processes. The presence of a trans-4-hydroxycyclohexyl group indicates that the compound has a cyclohexane ring with a hydroxyl (-OH) substituent, which can influence its solubility and interaction with biological systems. This compound may exhibit properties such as moderate polarity due to the hydroxyl and cyano groups, making it potentially useful in medicinal chemistry and as a building block in organic synthesis. Its specific characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique structure suggests potential applications in pharmaceuticals or agrochemicals.
Formula:C12H15N3O
InChI:InChI=1/C12H15N3O/c13-8-9-2-1-7-14-12(9)15-10-3-5-11(16)6-4-10/h1-2,7,10-11,16H,3-6H2,(H,14,15)/t10-,11-
InChI key:InChIKey=VECYBVRSUGIFCI-XYPYZODXNA-N
SMILES:N(C1=C(C#N)C=CC=N1)[C@@H]2CC[C@@H](O)CC2
Synonyms:
  • 3-Pyridinecarbonitrile, 2-[(trans-4-hydroxycyclohexyl)amino]-
  • 2-[(trans-4-Hydroxycyclohexyl)amino]-3-pyridinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.